4-Bromo-6-methoxyisoquinoline, 97%
cas: 1781486-94-9 — see every product listed under this CAS number, including other names
4-Bromo-6-methoxyisoquinoline, 97% (CAS 1781486-94-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1251647-100mg |
| cas | 1781486-94-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 815.38 Pln | |
| Ambeed | 250mg | 1416.12 Pln | |
| Ambeed | 1g | 3563.25 Pln | |
| Ambeed | 5g | 10549.75 Pln | |
| Chemat | 100mg | 813.20 Pln | |
| Chemat | 250mg | 1418.00 Pln | |
| Chemat | 1g | 3578.00 Pln | |
| Chemat | 5g | 14128.40 Pln | |
| BLDpharm | 100mg | 875.27 Pln | |
| BLDpharm | 250mg | 1519.49 Pln | |
| BLDpharm | 1g | 3835.34 Pln | |
| BLDpharm | 5g | 11366.02 Pln | |
| Fluorochem | 100mg | 1507.82 Pln | |
| Fluorochem | 250mg | 2637.63 Pln | |
| Fluorochem | 1g | 6511.27 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-bromo-6-methoxyisoquinoline (CAS 1781486-94-9) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 4-bromo-6-methoxyisoquinoline. InChIKey: AZELONYQOKQTQP-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 4-bromo-6-methoxyisoquinoline |
| InChIKey | AZELONYQOKQTQP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=NC=C2C=C1)Br |
Computed by PubChem (NCBI)