cas: 1360945-34-1 — see every product listed under this CAS number, including other names
4-Bromo-7-chloro-1H-benzo[d]imidazole 95% (CAS 1360945-34-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A157809-50mg |
| cas | 1360945-34-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 476.06 Pln | |
| Ambeed | 100mg | 726.38 Pln | |
| Ambeed | 250mg | 1110.19 Pln | |
| Ambeed | 1g | 2767.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A157809 |
7-bromo-4-chloro-1H-benzimidazole (CAS 1360945-34-1) is a chemical compound with the molecular formula C7H4BrClN2 and a molecular weight of 231.48 g/mol. IUPAC name: 7-bromo-4-chloro-1H-benzimidazole. InChIKey: CEUQSGOBJMLVLX-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2 |
|---|---|
| Molecular weight | 231.48 g/mol |
| IUPAC name | 7-bromo-4-chloro-1H-benzimidazole |
| InChIKey | CEUQSGOBJMLVLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)N=CN2)Br |
Computed by PubChem (NCBI)