cas: 436091-59-7 — see every product listed under this CAS number, including other names
4-Bromo-7-methoxy-1h-indole, 95% (CAS 436091-59-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QB-1354-1g |
| cas | 436091-59-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 100mg | price on request | |
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 539.41 Pln | |
| Fluorochem | 5g | 1762.94 Pln | |
| Fluorochem | 10g | 3470.67 Pln | |
| Fluorochem | 25g | 8588.66 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-bromo-7-methoxy-1H-indole (CAS 436091-59-7) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: 4-bromo-7-methoxy-1H-indole. InChIKey: WCEJDYPAEFIBCD-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 4-bromo-7-methoxy-1H-indole |
| InChIKey | WCEJDYPAEFIBCD-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)Br)C=CN2 |
Computed by PubChem (NCBI)