cas: 1704069-03-3 — see every product listed under this CAS number, including other names
4-Bromo-N-cyclopropyl-2,6-dimethylbenzenesulfonamide, 95%, 95% (CAS 1704069-03-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AROO-100mg |
| cas | 1704069-03-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 717.20 Pln | |
| Chemat | 250mg | 1302.80 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-bromo-N-cyclopropyl-2,6-dimethylbenzenesulfonamide (CAS 1704069-03-3) is a chemical compound with the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. IUPAC name: 4-bromo-N-cyclopropyl-2,6-dimethylbenzenesulfonamide. InChIKey: KJXYTYJJZHEEKA-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2S |
|---|---|
| Molecular weight | 304.21 g/mol |
| IUPAC name | 4-bromo-N-cyclopropyl-2,6-dimethylbenzenesulfonamide |
| InChIKey | KJXYTYJJZHEEKA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1S(=O)(=O)NC2CC2)C)Br |
Computed by PubChem (NCBI)