cas: 701-34-8 — see every product listed under this CAS number, including other names
4-Bromobenzenesulfonamide, 95% (CAS 701-34-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236562-1G |
| cas | 701-34-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 10g | 112.48 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 378.01 Pln | |
| Fluorochem | 500g | 1658.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-bromobenzenesulfonamide (CAS 701-34-8) is a chemical compound with the molecular formula C6H6BrNO2S and a molecular weight of 236.09 g/mol. IUPAC name: 4-bromobenzenesulfonamide. InChIKey: STYQHICBPYRHQK-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO2S |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 4-bromobenzenesulfonamide |
| InChIKey | STYQHICBPYRHQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)N)Br |
Computed by PubChem (NCBI)