cas: 498-83-9 — see every product listed under this CAS number, including other names
4-Bromobenzenesulfonyl fluoride 98% (CAS 498-83-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A612780-1g |
| cas | 498-83-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 25g | 1327.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A612780 |
4-bromobenzenesulfonyl fluoride (CAS 498-83-9) is a chemical compound with the molecular formula C6H4BrFO2S and a molecular weight of 239.06 g/mol. IUPAC name: 4-bromobenzenesulfonyl fluoride. InChIKey: AOXWZFUBFROIHA-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFO2S |
|---|---|
| Molecular weight | 239.06 g/mol |
| IUPAC name | 4-bromobenzenesulfonyl fluoride |
| InChIKey | AOXWZFUBFROIHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)F)Br |
Computed by PubChem (NCBI)