CAS 2638502-61-9 appears in our catalog under these names: 4-Bromofuro[2,3-f]quinazoline-7,9(6H,8H)-dione, 95%, 95%, 4-Bromofuro[2,3-f]quinazoline-7,9(6H,8H)-dione, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 25mg, 50mg, 100mg, 250mg.
4-bromo-6H-furo[2,3-f]quinazoline-7,9-dione (CAS 2638502-61-9) is a chemical compound with the molecular formula C10H5BrN2O3 and a molecular weight of 281.06 g/mol. IUPAC name: 4-bromo-6H-furo[2,3-f]quinazoline-7,9-dione. InChIKey: RQQUPTQUUXGPEM-UHFFFAOYSA-N.
| Molecular formula | C10H5BrN2O3 |
|---|---|
| Molecular weight | 281.06 g/mol |
| IUPAC name | 4-bromo-6H-furo[2,3-f]quinazoline-7,9-dione |
| InChIKey | RQQUPTQUUXGPEM-UHFFFAOYSA-N |
| SMILES | C1=COC2=C3C(=CC(=C21)Br)NC(=O)NC3=O |
Computed by PubChem (NCBI)