cas: 3277-79-0 — see every product listed under this CAS number, including other names
4-Bromophenyl cyclohexyl ketone, 98% (CAS 3277-79-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F204168-100MG |
| cas | 3277-79-0 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 643.54 Pln | |
| Fluorochem | 250mg | 1023.62 Pln | |
| Fluorochem | 1g | 1976.41 Pln | |
| Fluorochem | 5g | 6027.06 Pln | |
| Chemat | 100mg | 510.80 Pln | |
| Chemat | 250mg | 808.40 Pln | |
| Chemat | 1g | 1552.40 Pln | |
| Chemat | 5g | 4749.20 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(4-bromophenyl)-cyclohexylmethanone (CAS 3277-79-0) is a chemical compound with the molecular formula C13H15BrO and a molecular weight of 267.16 g/mol. IUPAC name: (4-bromophenyl)-cyclohexylmethanone. InChIKey: OSZVBPMTWSMMRS-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO |
|---|---|
| Molecular weight | 267.16 g/mol |
| IUPAC name | (4-bromophenyl)-cyclohexylmethanone |
| InChIKey | OSZVBPMTWSMMRS-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)