cas: 1141669-63-7 — see every product listed under this CAS number, including other names
4-Cbz-2-homomorpholinecarboxylic Acid, >95%, >95% (CAS 1141669-63-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111APO-1g |
| cas | 1141669-63-7 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1840.40 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
4-phenylmethoxycarbonyl-1,4-oxazepane-2-carboxylic acid (CAS 1141669-63-7) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: 4-phenylmethoxycarbonyl-1,4-oxazepane-2-carboxylic acid. InChIKey: AJQVXDQJBBKRTD-UHFFFAOYSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 4-phenylmethoxycarbonyl-1,4-oxazepane-2-carboxylic acid |
| InChIKey | AJQVXDQJBBKRTD-UHFFFAOYSA-N |
| SMILES | C1CN(CC(OC1)C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)