cas: 1264481-55-1 — see every product listed under this CAS number, including other names
4-Chloro-1H-indazole-3-carbonitrile (CAS 1264481-55-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12DTRY-1g |
| cas | 1264481-55-1 |
| size | 1g |
| availability | 54.8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1902.80 Pln | |
| Chemat | 5g | 4787.60 Pln | |
| Fluorochem | 1g | 3127.04 Pln |
| delivery time | 3 weeks |
|---|
4-chloro-1H-indazole-3-carbonitrile (CAS 1264481-55-1) is a chemical compound with the molecular formula C8H4ClN3 and a molecular weight of 177.59 g/mol. IUPAC name: 4-chloro-1H-indazole-3-carbonitrile. InChIKey: KWTONBMRLJOZHC-UHFFFAOYSA-N.
| Molecular formula | C8H4ClN3 |
|---|---|
| Molecular weight | 177.59 g/mol |
| IUPAC name | 4-chloro-1H-indazole-3-carbonitrile |
| InChIKey | KWTONBMRLJOZHC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=NN2)C#N |
Computed by PubChem (NCBI)