cas: 920965-87-3 — see every product listed under this CAS number, including other names
4-Chloro-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile, 95% (CAS 920965-87-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F325183-250MG |
| cas | 920965-87-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 674.78 Pln | |
| Fluorochem | 10g | 1294.35 Pln | |
| Fluorochem | 25g | 3028.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile (CAS 920965-87-3) is a chemical compound with the molecular formula C8H4ClN3 and a molecular weight of 177.59 g/mol. IUPAC name: 4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile. InChIKey: XQAJHQBDIDWDGZ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClN3 |
|---|---|
| Molecular weight | 177.59 g/mol |
| IUPAC name | 4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile |
| InChIKey | XQAJHQBDIDWDGZ-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1Cl)C(=CN2)C#N |
Computed by PubChem (NCBI)