cas: 1256346-26-5 — see every product listed under this CAS number, including other names
4-Chloro-2-fluoro-3-(2-methoxyethoxy)phenylboronic acid, 98%, 98% (CAS 1256346-26-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111O20-1g |
| cas | 1256346-26-5 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 674.00 Pln | |
| Chemat | 5g | 2200.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-chloro-2-fluoro-3-(2-methoxyethoxy)phenyl]boronic acid (CAS 1256346-26-5) is a chemical compound with the molecular formula C9H11BClFO4 and a molecular weight of 248.44 g/mol. IUPAC name: [4-chloro-2-fluoro-3-(2-methoxyethoxy)phenyl]boronic acid. InChIKey: FUXWTCCXYLIMOQ-UHFFFAOYSA-N.
| Molecular formula | C9H11BClFO4 |
|---|---|
| Molecular weight | 248.44 g/mol |
| IUPAC name | [4-chloro-2-fluoro-3-(2-methoxyethoxy)phenyl]boronic acid |
| InChIKey | FUXWTCCXYLIMOQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)OCCOC)F)(O)O |
Computed by PubChem (NCBI)