4-Chloro-2-methyl-3-nitroaniline, 95%
cas: 219312-08-0 — see every product listed under this CAS number, including other names
4-Chloro-2-methyl-3-nitroaniline, 95% (CAS 219312-08-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A708949-250mg |
| cas | 219312-08-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 670.75 Pln | |
| Ambeed | 1g | 1649.75 Pln | |
| Ambeed | 5g | 5626.94 Pln | |
| BLDpharm | 100mg | 469.86 Pln | |
| BLDpharm | 250mg | 719.77 Pln | |
| BLDpharm | 1g | 1774.96 Pln | |
| BLDpharm | 5g | 6062.33 Pln | |
| Chemat | 100mg | 458.00 Pln | |
| Chemat | 250mg | 698.00 Pln | |
| Chemat | 1g | 1710.80 Pln | |
| Chemat | 5g | 5834.00 Pln | |
| Fluorochem | 100mg | 830.98 Pln | |
| Fluorochem | 250mg | 1289.15 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-2-methyl-3-nitroaniline (CAS 219312-08-0) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: 4-chloro-2-methyl-3-nitroaniline. InChIKey: UKTHQISDMJUSCB-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 4-chloro-2-methyl-3-nitroaniline |
| InChIKey | UKTHQISDMJUSCB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1[N+](=O)[O-])Cl)N |
Computed by PubChem (NCBI)