cas: 5993-98-6 — see every product listed under this CAS number, including other names
4-Chloro-2-methyl-6-trifluoromethylpyrimidine, 97% (CAS 5993-98-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078300-1G |
| cas | 5993-98-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 378.01 Pln | |
| Fluorochem | 10g | 643.54 Pln | |
| Fluorochem | 25g | 1362.04 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-chloro-2-methyl-6-(trifluoromethyl)pyrimidine (CAS 5993-98-6) is a chemical compound with the molecular formula C6H4ClF3N2 and a molecular weight of 196.56 g/mol. IUPAC name: 4-chloro-2-methyl-6-(trifluoromethyl)pyrimidine. InChIKey: JYLBKMNTQSEPJM-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2 |
|---|---|
| Molecular weight | 196.56 g/mol |
| IUPAC name | 4-chloro-2-methyl-6-(trifluoromethyl)pyrimidine |
| InChIKey | JYLBKMNTQSEPJM-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)