4-Chloro-3-nitro-5-sulfamoylbenzoic acid, 94%, 94%
cas: 22892-96-2 — see every product listed under this CAS number, including other names
4-Chloro-3-nitro-5-sulfamoylbenzoic acid, 94%, 94% (CAS 22892-96-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113LDS-100mg |
| cas | 22892-96-2 |
| size | 100mg |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 266.00 Pln | |
| Chemat | 10g | 400.40 Pln | |
| Chemat | 25g | 741.20 Pln | |
| Chemat | 50g | 1163.60 Pln | |
| Chemat | 100g | 1648.40 Pln | |
| Chemat | 500g | 5923.20 Pln |
properties
| purity | 94% |
|---|---|
| delivery time | 3 weeks |
4-chloro-3-nitro-5-sulfamoylbenzoic acid (CAS 22892-96-2) is a chemical compound with the molecular formula C7H5ClN2O6S and a molecular weight of 280.64 g/mol. IUPAC name: 4-chloro-3-nitro-5-sulfamoylbenzoic acid. InChIKey: ACYLUAGCBGTEJF-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O6S |
|---|---|
| Molecular weight | 280.64 g/mol |
| IUPAC name | 4-chloro-3-nitro-5-sulfamoylbenzoic acid |
| InChIKey | ACYLUAGCBGTEJF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Chloro-3-nitro-5-sulphamoylbenzoic acid, Benzoic acid, 3-(aminosulfonyl)-4-chloro-5-nitro-, 3-(aminosulfonyl)-4-chloro-5-nitrobenzoic acid, 2-chloro-3-nitro-5-carboxy-benzenesulphonamide, 4-chloro-3-nitro-5-sulfamoylbenzoic acid, 4-Chloro-3-nitro-5-sulfamoyl-benzoic Acid, C7H5ClN2O6S, 4-chloro-5-nitro-3-sulfamoylbenzoic acid, Bumetanide Impurity 1, 4-Chloro-3-nitro-5-sulfamoylbenzoicAcid