cas: 70049-77-3 — see every product listed under this CAS number, including other names
4-Chloro-3-sulfamoylbenzoyl chloride, 98%, 98% (CAS 70049-77-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11F0X6-5g |
| cas | 70049-77-3 |
| size | 5g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 102.80 Pln | |
| Chemat | 25g | 218.00 Pln | |
| Chemat | 100g | 510.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-3-sulfamoylbenzoyl chloride (CAS 70049-77-3) is a chemical compound with the molecular formula C7H5Cl2NO3S and a molecular weight of 254.09 g/mol. IUPAC name: 4-chloro-3-sulfamoylbenzoyl chloride. InChIKey: SCYSJFKWFQZRJW-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO3S |
|---|---|
| Molecular weight | 254.09 g/mol |
| IUPAC name | 4-chloro-3-sulfamoylbenzoyl chloride |
| InChIKey | SCYSJFKWFQZRJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)Cl)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)