cas: 791602-75-0 — see every product listed under this CAS number, including other names
4-Chloro-5,7-difluoroquinazoline, 97%, 97% (CAS 791602-75-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GADC-100mg |
| cas | 791602-75-0 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 880.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-chloro-5,7-difluoroquinazoline (CAS 791602-75-0) is a chemical compound with the molecular formula C8H3ClF2N2 and a molecular weight of 200.57 g/mol. IUPAC name: 4-chloro-5,7-difluoroquinazoline. InChIKey: GYHQPNLHJJSYSN-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF2N2 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 4-chloro-5,7-difluoroquinazoline |
| InChIKey | GYHQPNLHJJSYSN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=CN=C2Cl)F)F |
Computed by PubChem (NCBI)