cas: 384351-45-5 — see every product listed under this CAS number, including other names
4-Chloro-5-(4-fluorophenyl)thieno[2,3-d]pyrimidine (CAS 384351-45-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F017097-250MG |
| cas | 384351-45-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1247.50 Pln | |
| Fluorochem | 1g | 2720.93 Pln | |
| Fluorochem | 5g | 7547.36 Pln | |
| Fluorochem | 500mg | 1841.04 Pln |
| delivery time | 2-3 weeks |
|---|
4-chloro-5-(4-fluorophenyl)thieno[2,3-d]pyrimidine (CAS 384351-45-5) is a chemical compound with the molecular formula C12H6ClFN2S and a molecular weight of 264.71 g/mol. IUPAC name: 4-chloro-5-(4-fluorophenyl)thieno[2,3-d]pyrimidine. InChIKey: CPLNBRLGQDLEKP-UHFFFAOYSA-N.
| Molecular formula | C12H6ClFN2S |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | 4-chloro-5-(4-fluorophenyl)thieno[2,3-d]pyrimidine |
| InChIKey | CPLNBRLGQDLEKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC3=C2C(=NC=N3)Cl)F |
Computed by PubChem (NCBI)