4-Chloro-5-iodo-2-methoxybenzoic acid, 98%
cas: 1440526-64-6 — see every product listed under this CAS number, including other names
4-Chloro-5-iodo-2-methoxybenzoic acid, 98% (CAS 1440526-64-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A406659-250mg |
| cas | 1440526-64-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 1087.94 Pln | |
| Ambeed | 25g | 3635.56 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 453.20 Pln | |
| BLDpharm | 5g | 1963.78 Pln | |
| BLDpharm | 25g | 3568.77 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-chloro-5-iodo-2-methoxybenzoic acid (CAS 1440526-64-6) is a chemical compound with the molecular formula C8H6ClIO3 and a molecular weight of 312.49 g/mol. IUPAC name: 4-chloro-5-iodo-2-methoxybenzoic acid. InChIKey: BXULZZPLSJNDTQ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClIO3 |
|---|---|
| Molecular weight | 312.49 g/mol |
| IUPAC name | 4-chloro-5-iodo-2-methoxybenzoic acid |
| InChIKey | BXULZZPLSJNDTQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)I)Cl |
Computed by PubChem (NCBI)