Products 1638764-84-7

CAS 1638764-84-7 is the registry number for 4-chloro-5-methyl-2,3-dihydropyridazin-3-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

5-chloro-4-methyl-1H-pyridazin-6-one (CAS 1638764-84-7) is a chemical compound with the molecular formula C5H5ClN2O and a molecular weight of 144.56 g/mol. IUPAC name: 5-chloro-4-methyl-1H-pyridazin-6-one. InChIKey: XIMMODMUMQZVGP-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5ClN2O
Molecular weight144.56 g/mol
IUPAC name5-chloro-4-methyl-1H-pyridazin-6-one
InChIKeyXIMMODMUMQZVGP-UHFFFAOYSA-N
SMILESCC1=C(C(=O)NN=C1)Cl

Computed by PubChem (NCBI)