cas: 1830311-70-0 — see every product listed under this CAS number, including other names
4-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-((2-(trimethylsilyl)ethoxy)methyl)-7H-pyrrolo[2,3-d]pyrimidine, 97%, 97% (CAS 1830311-70-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K7JS-100mg |
| cas | 1830311-70-0 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1394.00 Pln | |
| Chemat | 10g | 2128.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[[4-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (CAS 1830311-70-0) is a chemical compound with the molecular formula C18H29BClN3O3Si and a molecular weight of 409.8 g/mol. IUPAC name: 2-[[4-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane. InChIKey: KSFKKSLCGKTHOM-UHFFFAOYSA-N.
| Molecular formula | C18H29BClN3O3Si |
|---|---|
| Molecular weight | 409.8 g/mol |
| IUPAC name | 2-[[4-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| InChIKey | KSFKKSLCGKTHOM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2COCC[Si](C)(C)C)N=CN=C3Cl |
Computed by PubChem (NCBI)