cas: 1196153-86-2 — see every product listed under this CAS number, including other names
4-Chloro-6-(trifluoromethyl)pyridin-3-amine, 97%, 97% (CAS 1196153-86-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PB2-100mg |
| cas | 1196153-86-2 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 520.40 Pln | |
| Chemat | 500mg | 986.00 Pln | |
| Chemat | 1g | 1336.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-chloro-6-(trifluoromethyl)pyridin-3-amine (CAS 1196153-86-2) is a chemical compound with the molecular formula C6H4ClF3N2 and a molecular weight of 196.56 g/mol. IUPAC name: 4-chloro-6-(trifluoromethyl)pyridin-3-amine. InChIKey: XKRQUYRYIFNHNV-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2 |
|---|---|
| Molecular weight | 196.56 g/mol |
| IUPAC name | 4-chloro-6-(trifluoromethyl)pyridin-3-amine |
| InChIKey | XKRQUYRYIFNHNV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)N)Cl |
Computed by PubChem (NCBI)