cas: 492444-39-0 — see every product listed under this CAS number, including other names
4-Chloro-6-methoxy-7-(3-(4-methylpiperazin-1-yl)propoxy)quinoline-3-carbonitrile, 95% (CAS 492444-39-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A663435-100mg |
| cas | 492444-39-0 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 887.69 Pln | |
| Ambeed | 250mg | 1460.62 Pln | |
| Ambeed | 1g | 3808.00 Pln | |
| BLDpharm | 100mg | 875.27 Pln | |
| BLDpharm | 250mg | 1436.19 Pln | |
| BLDpharm | 1g | 3735.38 Pln | |
| Chemat | 100mg | 856.40 Pln | |
| Chemat | 250mg | 1408.40 Pln | |
| Chemat | 1g | 3698.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile (CAS 492444-39-0) is a chemical compound with the molecular formula C19H23ClN4O2 and a molecular weight of 374.9 g/mol. IUPAC name: 4-chloro-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile. InChIKey: DLILOBLDMMRASC-UHFFFAOYSA-N.
| Molecular formula | C19H23ClN4O2 |
|---|---|
| Molecular weight | 374.9 g/mol |
| IUPAC name | 4-chloro-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile |
| InChIKey | DLILOBLDMMRASC-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CCCOC2=C(C=C3C(=C2)N=CC(=C3Cl)C#N)OC |
Computed by PubChem (NCBI)