cas: 388572-67-6 — see every product listed under this CAS number, including other names
4-Chloro-7-cyclohexyl-6,7-dihydro-2-(methylthio)-(5H)-pyrrolo[2,3-d]pyrimidine (CAS 388572-67-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047962-1G |
| cas | 388572-67-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3153.07 Pln | |
| Fluorochem | 5g | 9905.90 Pln |
| delivery time | 2-3 weeks |
|---|
4-chloro-7-cyclohexyl-2-methylsulfanyl-5,6-dihydropyrrolo[2,3-d]pyrimidine (CAS 388572-67-6) is a chemical compound with the molecular formula C13H18ClN3S and a molecular weight of 283.82 g/mol. IUPAC name: 4-chloro-7-cyclohexyl-2-methylsulfanyl-5,6-dihydropyrrolo[2,3-d]pyrimidine. InChIKey: MQNDLMBKYMITMR-UHFFFAOYSA-N.
| Molecular formula | C13H18ClN3S |
|---|---|
| Molecular weight | 283.82 g/mol |
| IUPAC name | 4-chloro-7-cyclohexyl-2-methylsulfanyl-5,6-dihydropyrrolo[2,3-d]pyrimidine |
| InChIKey | MQNDLMBKYMITMR-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(CCN2C3CCCCC3)C(=N1)Cl |
Computed by PubChem (NCBI)