4-Chloro-8-fluoroquinoline, 97%
cas: 63010-72-0 — see every product listed under this CAS number, including other names
4-Chloro-8-fluoroquinoline, 97% (CAS 63010-72-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A100892-100mg |
| cas | 63010-72-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 470.50 Pln | |
| Ambeed | 25g | 926.62 Pln | |
| Ambeed | 100g | 3196.12 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 169.96 Pln | |
| BLDpharm | 5g | 503.18 Pln | |
| BLDpharm | 25g | 991.90 Pln | |
| BLDpharm | 100g | 3441.04 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-chloro-8-fluoroquinoline (CAS 63010-72-0) is a chemical compound with the molecular formula C9H5ClFN and a molecular weight of 181.59 g/mol. IUPAC name: 4-chloro-8-fluoroquinoline. InChIKey: NUIMKHDPMIPYFI-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFN |
|---|---|
| Molecular weight | 181.59 g/mol |
| IUPAC name | 4-chloro-8-fluoroquinoline |
| InChIKey | NUIMKHDPMIPYFI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=C1)F)Cl |
Computed by PubChem (NCBI)