cas: 181950-55-0 — see every product listed under this CAS number, including other names
4-Chloroquinoline-7-carbonitrile, 96%, 96% (CAS 181950-55-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113493-100mg |
| cas | 181950-55-0 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 530.00 Pln | |
| Chemat | 250mg | 856.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4-chloroquinoline-7-carbonitrile (CAS 181950-55-0) is a chemical compound with the molecular formula C10H5ClN2 and a molecular weight of 188.61 g/mol. IUPAC name: 4-chloroquinoline-7-carbonitrile. InChIKey: NFCSRTCOMSRFOC-UHFFFAOYSA-N.
| Molecular formula | C10H5ClN2 |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 4-chloroquinoline-7-carbonitrile |
| InChIKey | NFCSRTCOMSRFOC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1C#N)Cl |
Computed by PubChem (NCBI)