cas: 1884492-36-7 — see every product listed under this CAS number, including other names
4-Cyanophenylboronic acid MIDA ester 95% (CAS 1884492-36-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1148051-1g |
| cas | 1884492-36-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 731.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1148051 |
4-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzonitrile (CAS 1884492-36-7) is a chemical compound with the molecular formula C12H11BN2O4 and a molecular weight of 258.04 g/mol. IUPAC name: 4-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzonitrile. InChIKey: GSZJATWIBFKRFE-UHFFFAOYSA-N.
| Molecular formula | C12H11BN2O4 |
|---|---|
| Molecular weight | 258.04 g/mol |
| IUPAC name | 4-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzonitrile |
| InChIKey | GSZJATWIBFKRFE-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)