4-Cyclohexyl-1-phenylthiosemicarbazide
cas: 27421-91-6 — see every product listed under this CAS number, including other names
4-Cyclohexyl-1-phenylthiosemicarbazide (CAS 27421-91-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg. Offered by: TargetMol, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T1727-1mg |
| cas | 27421-91-6 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 419.13 Pln | |
| TargetMol | 2mg | 499.07 Pln | |
| TargetMol | 5mg | 651.67 Pln | |
| TargetMol | 10mg | 784.16 Pln | |
| TargetMol | 25mg | 1255.95 Pln | |
| TargetMol | 50mg | 1767.44 Pln | |
| Chemat | 1mg | 232.40 Pln | |
| Chemat | 2mg | 376.40 Pln | |
| Chemat | 5mg | 539.60 Pln | |
| Chemat | 10mg | 674.00 Pln | |
| Chemat | 25mg | 1178.00 Pln | |
| Chemat | 50mg | 1734.80 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 19 days |
1-anilino-3-cyclohexylthiourea (CAS 27421-91-6) is a chemical compound with the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. IUPAC name: 1-anilino-3-cyclohexylthiourea. InChIKey: DCFLHKOWKJTAAZ-UHFFFAOYSA-N.
| Molecular formula | C13H19N3S |
|---|---|
| Molecular weight | 249.38 g/mol |
| IUPAC name | 1-anilino-3-cyclohexylthiourea |
| InChIKey | DCFLHKOWKJTAAZ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=S)NNC2=CC=CC=C2 |
Computed by PubChem (NCBI)