4-Cyclohexyl-2,6-dimethoxyphenol, 97%
cas: 2682114-25-4 — see every product listed under this CAS number, including other names
4-Cyclohexyl-2,6-dimethoxyphenol, 97% (CAS 2682114-25-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25mg, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1349690-250mg |
| cas | 2682114-25-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1505.12 Pln | |
| BLDpharm | 25mg | 353.23 Pln | |
| BLDpharm | 50mg | 553.16 Pln | |
| BLDpharm | 100mg | 897.49 Pln | |
| BLDpharm | 250mg | 1475.06 Pln | |
| Chemat | 50mg | 592.40 Pln | |
| Chemat | 100mg | 966.80 Pln | |
| Chemat | 250mg | 1610.00 Pln | |
| Fluorochem | 250mg | 2991.67 Pln | |
| Fluorochem | 50mg | 1086.09 Pln | |
| Fluorochem | 100mg | 1788.97 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-cyclohexyl-2,6-dimethoxyphenol (CAS 2682114-25-4) is a chemical compound with the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. IUPAC name: 4-cyclohexyl-2,6-dimethoxyphenol. InChIKey: VWHROXUNBKTMBH-UHFFFAOYSA-N.
| Molecular formula | C14H20O3 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | 4-cyclohexyl-2,6-dimethoxyphenol |
| InChIKey | VWHROXUNBKTMBH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)OC)C2CCCCC2 |
Computed by PubChem (NCBI)