cas: 851334-92-4 — see every product listed under this CAS number, including other names
4-Ethoxycarbonyl-2-fluorophenylboronic acid, pinacol ester, 97%, 97% (CAS 851334-92-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119GE6-100mg |
| cas | 851334-92-4 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 328.40 Pln | |
| Chemat | 5g | 909.20 Pln | |
| Chemat | 10g | 1758.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 851334-92-4) is a chemical compound with the molecular formula C15H20BFO4 and a molecular weight of 294.13 g/mol. IUPAC name: ethyl 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: ZXSGWPHDXQZIAF-UHFFFAOYSA-N.
| Molecular formula | C15H20BFO4 |
|---|---|
| Molecular weight | 294.13 g/mol |
| IUPAC name | ethyl 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | ZXSGWPHDXQZIAF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)OCC)F |
Computed by PubChem (NCBI)