cas: 5785-70-6 — see every product listed under this CAS number, including other names
4-Ethoxycarbonyl-2-nitrophenylboronic acid, 97%, 97% (CAS 5785-70-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IAAP-250mg |
| cas | 5785-70-6 |
| size | 250mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 10g | 486.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-ethoxycarbonyl-2-nitrophenyl)boronic acid (CAS 5785-70-6) is a chemical compound with the molecular formula C9H10BNO6 and a molecular weight of 238.99 g/mol. IUPAC name: (4-ethoxycarbonyl-2-nitrophenyl)boronic acid. InChIKey: GCDAYMSNTGTFDC-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO6 |
|---|---|
| Molecular weight | 238.99 g/mol |
| IUPAC name | (4-ethoxycarbonyl-2-nitrophenyl)boronic acid |
| InChIKey | GCDAYMSNTGTFDC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OCC)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)