cas: 474709-72-3 — see every product listed under this CAS number, including other names
4-Ethoxycarbonyl-3-fluorophenylboronic acid pinacol ester (CAS 474709-72-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627546-1G |
| cas | 474709-72-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3824.71 Pln | |
| Fluorochem | 5g | 11327.28 Pln |
| delivery time | 3-4 weeks |
|---|
Ethyl 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 474709-72-3) is a chemical compound with the molecular formula C15H20BFO4 and a molecular weight of 294.13 g/mol. IUPAC name: ethyl 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: TXGGQXPDCQECLR-UHFFFAOYSA-N.
| Molecular formula | C15H20BFO4 |
|---|---|
| Molecular weight | 294.13 g/mol |
| IUPAC name | ethyl 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | TXGGQXPDCQECLR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)OCC)F |
Computed by PubChem (NCBI)