cas: 1038828-32-8 — see every product listed under this CAS number, including other names
4-FLUORO-2-HYDROXYBENZENEBORONIC ACID PINACOL ESTER, 97% (CAS 1038828-32-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F513777-100MG |
| cas | 1038828-32-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 5g | 1981.61 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1038828-32-8) is a chemical compound with the molecular formula C12H16BFO3 and a molecular weight of 238.06 g/mol. IUPAC name: 5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: PSQUBOBJDBVJIN-UHFFFAOYSA-N.
| Molecular formula | C12H16BFO3 |
|---|---|
| Molecular weight | 238.06 g/mol |
| IUPAC name | 5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | PSQUBOBJDBVJIN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)F)O |
Computed by PubChem (NCBI)