4-Fluoro-1H-indole-5-carbonitrile, 98%
cas: 1240113-42-1 — see every product listed under this CAS number, including other names
4-Fluoro-1H-indole-5-carbonitrile, 98% (CAS 1240113-42-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 500mg, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A358800-250mg |
| cas | 1240113-42-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 570.62 Pln | |
| Ambeed | 1g | 1349.38 Pln | |
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1283.60 Pln | |
| Chemat | 5g | 3227.60 Pln | |
| BLDpharm | 100mg | 386.56 Pln | |
| BLDpharm | 250mg | 614.25 Pln | |
| BLDpharm | 1g | 1452.85 Pln | |
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 586.27 Pln | |
| Fluorochem | 500mg | 955.93 Pln | |
| Fluorochem | 1g | 1351.62 Pln | |
| Fluorochem | 5g | 4006.94 Pln | |
| Fluorochem | 10g | 6714.32 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-fluoro-1H-indole-5-carbonitrile (CAS 1240113-42-1) is a chemical compound with the molecular formula C9H5FN2 and a molecular weight of 160.15 g/mol. IUPAC name: 4-fluoro-1H-indole-5-carbonitrile. InChIKey: MNWGXZUQFYDSGV-UHFFFAOYSA-N.
| Molecular formula | C9H5FN2 |
|---|---|
| Molecular weight | 160.15 g/mol |
| IUPAC name | 4-fluoro-1H-indole-5-carbonitrile |
| InChIKey | MNWGXZUQFYDSGV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2)C(=C1C#N)F |
Computed by PubChem (NCBI)