cas: 1398923-95-9 — see every product listed under this CAS number, including other names
4-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol 95% (CAS 1398923-95-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A180520-100mg |
| cas | 1398923-95-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 726.38 Pln | |
| Ambeed | 25g | 2428.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A180520 |
4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1398923-95-9) is a chemical compound with the molecular formula C12H16BFO3 and a molecular weight of 238.06 g/mol. IUPAC name: 4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: GXQGRXFGHPKHTH-UHFFFAOYSA-N.
| Molecular formula | C12H16BFO3 |
|---|---|
| Molecular weight | 238.06 g/mol |
| IUPAC name | 4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | GXQGRXFGHPKHTH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)O)F |
Computed by PubChem (NCBI)