cas: 1197193-16-0 — see every product listed under this CAS number, including other names
4-Fluoro-3-(4-methylpiperazin-1-yl)benzaldehyde (CAS 1197193-16-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F446609-250MG |
| cas | 1197193-16-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 700.81 Pln | |
| Fluorochem | 1g | 1325.59 Pln | |
| Fluorochem | 5g | 4069.42 Pln |
| delivery time | 3-4 weeks |
|---|
4-fluoro-3-(4-methylpiperazin-1-yl)benzaldehyde (CAS 1197193-16-0) is a chemical compound with the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. IUPAC name: 4-fluoro-3-(4-methylpiperazin-1-yl)benzaldehyde. InChIKey: LKLSDLACNUEQLH-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2O |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | 4-fluoro-3-(4-methylpiperazin-1-yl)benzaldehyde |
| InChIKey | LKLSDLACNUEQLH-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=CC(=C2)C=O)F |
Computed by PubChem (NCBI)