cas: 42564-51-2 — see every product listed under this CAS number, including other names
4-Fluoro-3-nitrobenzaldehyde 98% (CAS 42564-51-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A138437-1g |
| cas | 42564-51-2 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 381.50 Pln | |
| Ambeed | 500g | 1610.81 Pln | |
| Ambeed | 1000g | 2534.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A138437 |
4-fluoro-3-nitrobenzaldehyde (CAS 42564-51-2) is a chemical compound with the molecular formula C7H4FNO3 and a molecular weight of 169.11 g/mol. IUPAC name: 4-fluoro-3-nitrobenzaldehyde. InChIKey: ILKWFRCNNILIJW-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO3 |
|---|---|
| Molecular weight | 169.11 g/mol |
| IUPAC name | 4-fluoro-3-nitrobenzaldehyde |
| InChIKey | ILKWFRCNNILIJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)[N+](=O)[O-])F |
Computed by PubChem (NCBI)