cas: 1469930-84-4 — see every product listed under this CAS number, including other names
4-Fluoro-N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzenesulfonamide 98% (CAS 1469930-84-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1355331-250mg |
| cas | 1469930-84-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1171.38 Pln | |
| Ambeed | 5g | 4180.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1355331 |
4-fluoro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide (CAS 1469930-84-4) is a chemical compound with the molecular formula C18H21BFNO4S and a molecular weight of 377.2 g/mol. IUPAC name: 4-fluoro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide. InChIKey: MQCOAJIVRNEYIQ-UHFFFAOYSA-N.
| Molecular formula | C18H21BFNO4S |
|---|---|
| Molecular weight | 377.2 g/mol |
| IUPAC name | 4-fluoro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide |
| InChIKey | MQCOAJIVRNEYIQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NS(=O)(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)