cas: 587-79-1 — see every product listed under this CAS number, including other names
4-Fluorodiphenylmethane (CAS 587-79-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009194-1G |
| cas | 587-79-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 331.15 Pln | |
| Fluorochem | 5g | 883.04 Pln | |
| Fluorochem | 25g | 3418.61 Pln | |
| Fluorochem | 100g | 12842.37 Pln |
| delivery time | 3-4 weeks |
|---|
1-benzyl-4-fluorobenzene (CAS 587-79-1) is a chemical compound with the molecular formula C13H11F and a molecular weight of 186.22 g/mol. IUPAC name: 1-benzyl-4-fluorobenzene. InChIKey: ADCBAIUWZPOIMC-UHFFFAOYSA-N.
| Molecular formula | C13H11F |
|---|---|
| Molecular weight | 186.22 g/mol |
| IUPAC name | 1-benzyl-4-fluorobenzene |
| InChIKey | ADCBAIUWZPOIMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)