4-Fluoronaphthalene-1-boronic acid, 98%
cas: 182344-25-8 — see every product listed under this CAS number, including other names
4-Fluoronaphthalene-1-boronic acid, 98% (CAS 182344-25-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A181307-100mg |
| cas | 182344-25-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 10g | 687.44 Pln | |
| Ambeed | 25g | 1616.38 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 25g | 1086.80 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 158.86 Pln | |
| BLDpharm | 5g | 408.77 Pln | |
| BLDpharm | 25g | 1736.08 Pln | |
| Fluorochem | 1g | 148.92 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 700.81 Pln | |
| Fluorochem | 25g | 1669.22 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4-fluoronaphthalen-1-yl)boronic acid (CAS 182344-25-8) is a chemical compound with the molecular formula C10H8BFO2 and a molecular weight of 189.98 g/mol. IUPAC name: (4-fluoronaphthalen-1-yl)boronic acid. InChIKey: IDCGAEJGZLYEAZ-UHFFFAOYSA-N.
| Molecular formula | C10H8BFO2 |
|---|---|
| Molecular weight | 189.98 g/mol |
| IUPAC name | (4-fluoronaphthalen-1-yl)boronic acid |
| InChIKey | IDCGAEJGZLYEAZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C2=CC=CC=C12)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Fluoro-1-naphthaleneboronic Acid (contains varying amounts of Anhydride), 4-Fluoronaphtalene-1-boronic acid, (4-fluoronaphthalen-1-yl)boronic Acid, 4-fluoronaphthalen-1-ylboronic acid, Boronic acid, B-(4-fluoro-1-naphthalenyl)-, Boronic acid, (4-fluoro-1-naphthalenyl)-, 4-fluoronaphth-1-ylboronic acid, 4-Fluoro-1-naphthaleneboronicacid, IDCGAEJGZLYEAZ-UHFFFAOYSA-N