4-Fmoc-1-Boc-piperazine-2-carboxylic acid 95%
cas: 218278-58-1 — see every product listed under this CAS number, including other names
4-Fmoc-1-Boc-piperazine-2-carboxylic acid 95% (CAS 218278-58-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A809404-250mg |
| cas | 218278-58-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 748.62 Pln | |
| Ambeed | 25g | 2795.62 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A809404 |
4-(9H-fluoren-9-ylmethoxycarbonyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (CAS 218278-58-1) is a chemical compound with the molecular formula C25H28N2O6 and a molecular weight of 452.5 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid. InChIKey: ZVHNNCSUTNWKFC-UHFFFAOYSA-N.
| Molecular formula | C25H28N2O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
| InChIKey | ZVHNNCSUTNWKFC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
1-boc-4-fmoc-2-piperazinecarboxylic acid, N-1-Boc-N-4-Fmoc-2-piperazine carboxylic acid, 1-Boc-4-Fmoc-piperazine-2-carboxylic acid, 4-fmoc-1-boc-piperazine-2-carboxylic acid, n1-boc-n4-fmoc-piperazine-2-carboxylic acid, ZVHNNCSUTNWKFC-UHFFFAOYSA-N, 1-Boc-4-Fmoc-2-Piperazine Carboxylic Acid, 4-(9H-fluoren-9-ylmethoxycarbonyl)-1-[(2-methylpropan-2-yl)oxycar