cas: 206564-00-3 — see every product listed under this CAS number, including other names
4-Furan-2-yl-pyrimidin-2-ylamine (CAS 206564-00-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F030324-1G |
| cas | 206564-00-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 862.21 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 5g | 1945.17 Pln |
| delivery time | 2-3 weeks |
|---|
4-(furan-2-yl)pyrimidin-2-amine (CAS 206564-00-3) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 4-(furan-2-yl)pyrimidin-2-amine. InChIKey: JTOGGBLTIHXWEH-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 4-(furan-2-yl)pyrimidin-2-amine |
| InChIKey | JTOGGBLTIHXWEH-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NC(=NC=C2)N |
Computed by PubChem (NCBI)