cas: 7770-45-8 — see every product listed under this CAS number, including other names
4-Hydroxy-1-naphthaldehyde, 95% (CAS 7770-45-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QH-4706-1g |
| cas | 7770-45-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 100mg | 91.65 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 346.77 Pln | |
| Fluorochem | 10g | 627.92 Pln | |
| Fluorochem | 25g | 1486.99 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-hydroxynaphthalene-1-carbaldehyde (CAS 7770-45-8) is a chemical compound with the molecular formula C11H8O2 and a molecular weight of 172.18 g/mol. IUPAC name: 4-hydroxynaphthalene-1-carbaldehyde. InChIKey: LORPDGZOLAPNHP-UHFFFAOYSA-N.
| Molecular formula | C11H8O2 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 4-hydroxynaphthalene-1-carbaldehyde |
| InChIKey | LORPDGZOLAPNHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2O)C=O |
Computed by PubChem (NCBI)