4-Hydroxy-5-((2-hydroxybenzylidene)amino)naphthalene-2,7-disulfonic acid
cas: 32266-60-7 — see every product listed under this CAS number, including other names
4-Hydroxy-5-((2-hydroxybenzylidene)amino)naphthalene-2,7-disulfonic acid (CAS 32266-60-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114LIE-250mg |
| cas | 32266-60-7 |
| size | 250mg |
| availability | 2000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 429.20 Pln | |
| Chemat | 25g | 856.40 Pln | |
| Chemat | 100g | 2488.40 Pln | |
| Chemat | 500g | 8068.80 Pln | |
| Fluorochem | 250mg | 180.16 Pln | |
| Fluorochem | 1g | 398.84 Pln | |
| Fluorochem | 5g | 778.91 Pln | |
| Fluorochem | 25g | 1591.12 Pln | |
| Fluorochem | 100g | 4610.89 Pln |
properties
| delivery time | 3 weeks |
|---|
4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]naphthalene-2,7-disulfonic acid (CAS 32266-60-7) is a chemical compound with the molecular formula C17H13NO8S2 and a molecular weight of 423.4 g/mol. IUPAC name: 4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]naphthalene-2,7-disulfonic acid. InChIKey: DUCCKQSNXPFEGT-UHFFFAOYSA-N.
| Molecular formula | C17H13NO8S2 |
|---|---|
| Molecular weight | 423.4 g/mol |
| IUPAC name | 4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]naphthalene-2,7-disulfonic acid |
| InChIKey | DUCCKQSNXPFEGT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=NC2=C3C(=CC(=C2)S(=O)(=O)O)C=C(C=C3O)S(=O)(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Hydroxy-5-((2-hydroxybenzylidene)amino)naphthalene-2,7-disulfonic acid, Azomethine H, Azomethine-H, azomethine-h monosodium, 4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]naphthalene-2,7-disulfonic acid, Azomethine-H (>90%), 4-Hydroxy-5-(salicylidene-amino)-2,7-naphthalenedisulfonic acid, 4-hydroxy-5-{[(2-hydroxyphenyl)methylidene]amino}naphthalene-2,7-disulfonic acid, NCIStruc1_001287, NCIStruc2_001778