cas: 342617-07-6 — see every product listed under this CAS number, including other names
4-Hydroxy-6-iodoquinoline, 95% (CAS 342617-07-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093285-250MG |
| cas | 342617-07-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 10g | 830.98 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-iodo-1H-quinolin-4-one (CAS 342617-07-6) is a chemical compound with the molecular formula C9H6INO and a molecular weight of 271.05 g/mol. IUPAC name: 6-iodo-1H-quinolin-4-one. InChIKey: ZAZOVHUNVUSQMU-UHFFFAOYSA-N.
| Molecular formula | C9H6INO |
|---|---|
| Molecular weight | 271.05 g/mol |
| IUPAC name | 6-iodo-1H-quinolin-4-one |
| InChIKey | ZAZOVHUNVUSQMU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C(=O)C=CN2 |
Computed by PubChem (NCBI)