cas: 2305-65-9 — see every product listed under this CAS number, including other names
4-Hydroxy-6-nitroquinoline-3-carbonitrile, 95%, 95% (CAS 2305-65-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DLOQ-1g |
| cas | 2305-65-9 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 381.20 Pln | |
| Chemat | 5g | 971.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-nitro-4-oxo-1H-quinoline-3-carbonitrile (CAS 2305-65-9) is a chemical compound with the molecular formula C10H5N3O3 and a molecular weight of 215.16 g/mol. IUPAC name: 6-nitro-4-oxo-1H-quinoline-3-carbonitrile. InChIKey: PZIXIFBGEDRCAM-UHFFFAOYSA-N.
| Molecular formula | C10H5N3O3 |
|---|---|
| Molecular weight | 215.16 g/mol |
| IUPAC name | 6-nitro-4-oxo-1H-quinoline-3-carbonitrile |
| InChIKey | PZIXIFBGEDRCAM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)C(=CN2)C#N |
Computed by PubChem (NCBI)