cas: 24444-75-5 — see every product listed under this CAS number, including other names
4-Hydroxydibenzothiophene, 95+%, 95+% (CAS 24444-75-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118N0D-100mg |
| cas | 24444-75-5 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 602.00 Pln | |
| Chemat | 5g | 2003.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
Dibenzothiophen-4-ol (CAS 24444-75-5) is a chemical compound with the molecular formula C12H8OS and a molecular weight of 200.26 g/mol. IUPAC name: dibenzothiophen-4-ol. InChIKey: SUBWJLQUFMWZRI-UHFFFAOYSA-N.
| Molecular formula | C12H8OS |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | dibenzothiophen-4-ol |
| InChIKey | SUBWJLQUFMWZRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C(=CC=C3)O |
Computed by PubChem (NCBI)