CAS 3419-51-0 appears in our catalog under these names: 4-Iodo-3,5-dimethyl-1,1'-biphenyl, 98%, 4-Iodo-3,5-dimethylbiphenyl, ≥97%, ≥97%, 4-IODO-3,5-DIMETHYLBIPHENYL, ≥97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
2-iodo-1,3-dimethyl-5-phenylbenzene (CAS 3419-51-0) is a chemical compound with the molecular formula C14H13I and a molecular weight of 308.16 g/mol. IUPAC name: 2-iodo-1,3-dimethyl-5-phenylbenzene. InChIKey: DSTCZMJNWRLHMU-UHFFFAOYSA-N.
| Molecular formula | C14H13I |
|---|---|
| Molecular weight | 308.16 g/mol |
| IUPAC name | 2-iodo-1,3-dimethyl-5-phenylbenzene |
| InChIKey | DSTCZMJNWRLHMU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1I)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)