cas: 134283-64-0 — see every product listed under this CAS number, including other names
4-Iodo-N-methylbenzene-1-sulfonamide 98% (CAS 134283-64-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1129605-250mg |
| cas | 134283-64-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 726.38 Pln | |
| Ambeed | 5g | 2189.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1129605 |
4-iodo-N-methylbenzenesulfonamide (CAS 134283-64-0) is a chemical compound with the molecular formula C7H8INO2S and a molecular weight of 297.12 g/mol. IUPAC name: 4-iodo-N-methylbenzenesulfonamide. InChIKey: CUHGLHPNTLMRLA-UHFFFAOYSA-N.
| Molecular formula | C7H8INO2S |
|---|---|
| Molecular weight | 297.12 g/mol |
| IUPAC name | 4-iodo-N-methylbenzenesulfonamide |
| InChIKey | CUHGLHPNTLMRLA-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC=C(C=C1)I |
Computed by PubChem (NCBI)