cas: 1704064-31-2 — see every product listed under this CAS number, including other names
4-METHYL-3-(3-(4-METHYLPIPERAZIN-1-YL)PROPOXY)PHENYLBORONIC ACID, 97% (CAS 1704064-31-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F859932-100MG |
| cas | 1704064-31-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[4-methyl-3-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]boronic acid (CAS 1704064-31-2) is a chemical compound with the molecular formula C15H25BN2O3 and a molecular weight of 292.18 g/mol. IUPAC name: [4-methyl-3-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]boronic acid. InChIKey: HOLVQFCYTSHUEA-UHFFFAOYSA-N.
| Molecular formula | C15H25BN2O3 |
|---|---|
| Molecular weight | 292.18 g/mol |
| IUPAC name | [4-methyl-3-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]boronic acid |
| InChIKey | HOLVQFCYTSHUEA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)OCCCN2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)